C21H27NO2 — CID 134997675
tert-butyl N-[2-[(2S)-1-phenylbutan-2-yl]phenyl]carbamate (PubChem CID 134997675) has the molecular formula C21H27NO2 and a molecular weight of 325.45 g/mol. Its IUPAC name is tert-butyl N-[2-[(2S)-1-phenylbutan-2-yl]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-[(2S)-1-phenylbutan-2-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 134997675 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | tert-butyl N-[2-[(2S)-1-phenylbutan-2-yl]phenyl]carbamate |
| SMILES | CC[C@@H](Cc1ccccc1)c1ccccc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H27NO2/c1-5-17(15-16-11-7-6-8-12-16)18-13-9-10-14-19(18)22-20(23)24-21(2,3)4/h6-14,17H,5,15H2,1-4H3,(H,22,23)/t17-/m0/s1 |
| InChIKey | LBUUGGLXOUPKOQ-KRWDZBQOSA-N |
| XLogP | 5.77 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |