About cis-(1R,2S)-2-[(2R)-2-hydroxy-3-tri(propan-2-yl)silyloxypropyl]-1-methylcyclopropan-1-ol
cis-(1R,2S)-2-[(2R)-2-hydroxy-3-tri(propan-2-yl)silyloxypropyl]-1-methylcyclopropan-1-ol (PubChem CID 134997755) has the molecular formula C16H34O3Si
and a molecular weight of 302.53 g/mol. Its IUPAC name is cis-(1R,2S)-2-[(2R)-2-hydroxy-3-tri(propan-2-yl)silyloxypropyl]-1-methylcyclopropan-1-ol.
Molecular Properties
| Compound Name | cis-(1R,2S)-2-[(2R)-2-hydroxy-3-tri(propan-2-yl)silyloxypropyl]-1-methylcyclopropan-1-ol |
| PubChem CID | 134997755 |
| Molecular Formula | C16H34O3Si |
| Molecular Weight | 302.53 g/mol |
| Exact Mass | 302.23 |
| IUPAC Name | cis-(1R,2S)-2-[(2R)-2-hydroxy-3-tri(propan-2-yl)silyloxypropyl]-1-methylcyclopropan-1-ol |
| SMILES | CC(C)[Si](OC[C@H](O)C[C@H]1C[C@@]1(C)O)(C(C)C)C(C)C |
| InChI | InChI=1S/C16H34O3Si/c1-11(2)20(12(3)4,13(5)6)19-10-15(17)8-14-9-16(14,7)18/h11-15,17-18H,8-10H2,1-7H3/t14-,15+,16+/m0/s1 |
| InChIKey | OLIRCLRHIWHMDG-ARFHVFGLSA-N |
| XLogP | 3.70 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.53 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cis-(1R,2S)-2-[(2R)-2-hydroxy-3-tri(propan-2-yl)silyloxypropyl]-1-methylcyclopropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1R,2S)-2-[(2R)-2-hydroxy-3-tri(propan-2-yl)silyloxypropyl]-1-methylcyclopropan-1-ol?
The IUPAC name of cis-(1R,2S)-2-[(2R)-2-hydroxy-3-tri(propan-2-yl)silyloxypropyl]-1-methylcyclopropan-1-ol (CID 134997755) is cis-(1R,2S)-2-[(2R)-2-hydroxy-3-tri(propan-2-yl)silyloxypropyl]-1-methylcyclopropan-1-ol.
What is the SMILES notation for cis-(1R,2S)-2-[(2R)-2-hydroxy-3-tri(propan-2-yl)silyloxypropyl]-1-methylcyclopropan-1-ol?
The canonical SMILES for cis-(1R,2S)-2-[(2R)-2-hydroxy-3-tri(propan-2-yl)silyloxypropyl]-1-methylcyclopropan-1-ol is CC(C)[Si](OC[C@H](O)C[C@H]1C[C@@]1(C)O)(C(C)C)C(C)C.
What is the InChIKey of cis-(1R,2S)-2-[(2R)-2-hydroxy-3-tri(propan-2-yl)silyloxypropyl]-1-methylcyclopropan-1-ol?
The InChIKey is OLIRCLRHIWHMDG-ARFHVFGLSA-N. The full InChI is InChI=1S/C16H34O3Si/c1-11(2)20(12(3)4,13(5)6)19-10-15(17)8-14-9-16(14,7)18/h11-15,17-18H,8-10H2,1-7H3/t14-,15+,16+/m0/s1.
What are the key properties of cis-(1R,2S)-2-[(2R)-2-hydroxy-3-tri(propan-2-yl)silyloxypropyl]-1-methylcyclopropan-1-ol?
cis-(1R,2S)-2-[(2R)-2-hydroxy-3-tri(propan-2-yl)silyloxypropyl]-1-methylcyclopropan-1-ol has a molecular weight of 302.53 g/mol, XLogP of 3.70, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,2S)-2-[(2R)-2-hydroxy-3-tri(propan-2-yl)silyloxypropyl]-1-methylcyclopropan-1-ol is sourced from PubChem (CID 134997755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).