C21H27NO7 — CID 134997999
2-O-benzyl 4-O-methyl (3R,4R,5S)-3-cyclopentyl-5-(2-methoxy-2-oxoethyl)-1,2-oxazolidine-2,4-dicarboxylate (PubChem CID 134997999) has the molecular formula C21H27NO7 and a molecular weight of 405.45 g/mol. Its IUPAC name is 2-O-benzyl 4-O-methyl (3R,4R,5S)-3-cyclopentyl-5-(2-methoxy-2-oxoethyl)-1,2-oxazolidine-2,4-dicarboxylate.
| Compound Name | 2-O-benzyl 4-O-methyl (3R,4R,5S)-3-cyclopentyl-5-(2-methoxy-2-oxoethyl)-1,2-oxazolidine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 134997999 |
| Molecular Formula | C21H27NO7 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | 2-O-benzyl 4-O-methyl (3R,4R,5S)-3-cyclopentyl-5-(2-methoxy-2-oxoethyl)-1,2-oxazolidine-2,4-dicarboxylate |
| SMILES | COC(=O)C[C@@H]1ON(C(=O)OCc2ccccc2)[C@H](C2CCCC2)[C@H]1C(=O)OC |
| InChI | InChI=1S/C21H27NO7/c1-26-17(23)12-16-18(20(24)27-2)19(15-10-6-7-11-15)22(29-16)21(25)28-13-14-8-4-3-5-9-14/h3-5,8-9,15-16,18-19H,6-7,10-13H2,1-2H3/t16-,18-,19+/m0/s1 |
| InChIKey | DTNWUEUTRCOJHX-YTQUADARSA-N |
| XLogP | 2.85 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|