C12H9Cl3N6 — CID 134998100
[2,4-dichloro-7-(4-chlorophenyl)-4a,7-dihydropyrimido[4,5-d]pyrimidin-5-yl]hydrazine (PubChem CID 134998100) has the molecular formula C12H9Cl3N6 and a molecular weight of 343.61 g/mol. Its IUPAC name is [2,4-dichloro-7-(4-chlorophenyl)-4a,7-dihydropyrimido[4,5-d]pyrimidin-5-yl]hydrazine.
| Compound Name | [2,4-dichloro-7-(4-chlorophenyl)-4a,7-dihydropyrimido[4,5-d]pyrimidin-5-yl]hydrazine |
|---|---|
| PubChem CID | 134998100 |
| Molecular Formula | C12H9Cl3N6 |
| Molecular Weight | 343.61 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | [2,4-dichloro-7-(4-chlorophenyl)-4a,7-dihydropyrimido[4,5-d]pyrimidin-5-yl]hydrazine |
| SMILES | NNC1=NC(c2ccc(Cl)cc2)N=C2N=C(Cl)N=C(Cl)C21 |
| InChI | InChI=1S/C12H9Cl3N6/c13-6-3-1-5(2-4-6)9-18-10-7(11(19-9)21-16)8(14)17-12(15)20-10/h1-4,7,9H,16H2,(H,19,21) |
| InChIKey | MSAXMFCKUYGWCJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.61 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|