potassium 2,2-dimethylpropanoyl-bis(trimethylsilyl)silanide

C11H27KOSi3 — CID 134998153

IUPACpotassium 2,2-dimethylpropanoyl-bis(trimethylsilyl)silanide
SMILESCC(C)(C)C(=O)[Si-]([Si](C)(C)C)[Si](C)(C)C.[K+]
InChIInChI=1S/C11H27OSi3.K/c1-11(2,3)10(12)13(14(4,5)6)15(7,8)9;/h1-9H3;/q-1;+1
InChIKeyMJGRJBCDCYIGST-UHFFFAOYSA-N
MW298.69 g/mol
LogP0.47
Rot. Bonds3

About potassium 2,2-dimethylpropanoyl-bis(trimethylsilyl)silanide

potassium 2,2-dimethylpropanoyl-bis(trimethylsilyl)silanide (PubChem CID 134998153) has the molecular formula C11H27KOSi3 and a molecular weight of 298.69 g/mol. Its IUPAC name is potassium 2,2-dimethylpropanoyl-bis(trimethylsilyl)silanide.

Molecular Properties

Compound Namepotassium 2,2-dimethylpropanoyl-bis(trimethylsilyl)silanide
PubChem CID134998153
Molecular FormulaC11H27KOSi3
Molecular Weight298.69 g/mol
Exact Mass298.10
IUPAC Namepotassium 2,2-dimethylpropanoyl-bis(trimethylsilyl)silanide
SMILESCC(C)(C)C(=O)[Si-]([Si](C)(C)C)[Si](C)(C)C.[K+]
InChIInChI=1S/C11H27OSi3.K/c1-11(2,3)10(12)13(14(4,5)6)15(7,8)9;/h1-9H3;/q-1;+1
InChIKeyMJGRJBCDCYIGST-UHFFFAOYSA-N
XLogP0.47
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500298.69
LogP ≤ 50.47
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze potassium 2,2-dimethylpropanoyl-bis(trimethylsilyl)silanide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium 2,2-dimethylpropanoyl-bis(trimethylsilyl)silanide?
The IUPAC name of potassium 2,2-dimethylpropanoyl-bis(trimethylsilyl)silanide (CID 134998153) is potassium 2,2-dimethylpropanoyl-bis(trimethylsilyl)silanide.
What is the SMILES notation for potassium 2,2-dimethylpropanoyl-bis(trimethylsilyl)silanide?
The canonical SMILES for potassium 2,2-dimethylpropanoyl-bis(trimethylsilyl)silanide is CC(C)(C)C(=O)[Si-]([Si](C)(C)C)[Si](C)(C)C.[K+].
What is the InChIKey of potassium 2,2-dimethylpropanoyl-bis(trimethylsilyl)silanide?
The InChIKey is MJGRJBCDCYIGST-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H27OSi3.K/c1-11(2,3)10(12)13(14(4,5)6)15(7,8)9;/h1-9H3;/q-1;+1.
What are the key properties of potassium 2,2-dimethylpropanoyl-bis(trimethylsilyl)silanide?
potassium 2,2-dimethylpropanoyl-bis(trimethylsilyl)silanide has a molecular weight of 298.69 g/mol, XLogP of 0.47, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 2,2-dimethylpropanoyl-bis(trimethylsilyl)silanide is sourced from PubChem (CID 134998153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).