C20H13F9O6S — CID 134998154
ethyl 2-benzoyl-4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy)benzoate (PubChem CID 134998154) has the molecular formula C20H13F9O6S and a molecular weight of 552.37 g/mol. Its IUPAC name is ethyl 2-benzoyl-4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy)benzoate.
| Compound Name | ethyl 2-benzoyl-4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy)benzoate |
|---|---|
| PubChem CID | 134998154 |
| Molecular Formula | C20H13F9O6S |
| Molecular Weight | 552.37 g/mol |
| Exact Mass | 552.03 |
| IUPAC Name | ethyl 2-benzoyl-4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy)benzoate |
| SMILES | CCOC(=O)c1ccc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C20H13F9O6S/c1-2-34-16(31)13-9-8-12(10-14(13)15(30)11-6-4-3-5-7-11)35-36(32,33)20(28,29)18(23,24)17(21,22)19(25,26)27/h3-10H,2H2,1H3 |
| InChIKey | IFJDUZVUVKNNCP-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.37 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|