C10H18O4 — CID 134998176
propan-2-yl 2-(6-hydroxyoxan-2-yl)acetate (PubChem CID 134998176) has the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. Its IUPAC name is propan-2-yl 2-(6-hydroxyoxan-2-yl)acetate.
| Compound Name | propan-2-yl 2-(6-hydroxyoxan-2-yl)acetate |
|---|---|
| PubChem CID | 134998176 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | propan-2-yl 2-(6-hydroxyoxan-2-yl)acetate |
| SMILES | CC(C)OC(=O)CC1CCCC(O)O1 |
| InChI | InChI=1S/C10H18O4/c1-7(2)13-10(12)6-8-4-3-5-9(11)14-8/h7-9,11H,3-6H2,1-2H3 |
| InChIKey | ZDEZMSZESWQTDH-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |