C28H37NO2 — CID 134998487
(1S,8S,15R)-8-[(2-methoxyphenyl)methyl]-8,11,11,15-tetramethyl-18-oxa-10-azatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6-triene (PubChem CID 134998487) has the molecular formula C28H37NO2 and a molecular weight of 419.61 g/mol. Its IUPAC name is (1S,8S,15R)-8-[(2-methoxyphenyl)methyl]-8,11,11,15-tetramethyl-18-oxa-10-azatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6-triene.
| Compound Name | (1S,8S,15R)-8-[(2-methoxyphenyl)methyl]-8,11,11,15-tetramethyl-18-oxa-10-azatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6-triene |
|---|---|
| PubChem CID | 134998487 |
| Molecular Formula | C28H37NO2 |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.28 |
| IUPAC Name | (1S,8S,15R)-8-[(2-methoxyphenyl)methyl]-8,11,11,15-tetramethyl-18-oxa-10-azatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6-triene |
| SMILES | COc1ccccc1C[C@]1(C)CN2[C@@H](OC3C[C@H](C)CCC3C2(C)C)c2ccccc21 |
| InChI | InChI=1S/C28H37NO2/c1-19-14-15-23-25(16-19)31-26-21-11-7-8-12-22(21)28(4,18-29(26)27(23,2)3)17-20-10-6-9-13-24(20)30-5/h6-13,19,23,25-26H,14-18H2,1-5H3/t19-,23?,25?,26+,28-/m1/s1 |
| InChIKey | GCLUFFYHGQNLKL-RJBCAJJDSA-N |
| XLogP | 6.12 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |