C17H19N3OS — CID 134998696
2-[(3R)-2-deuterio-3-(4-methyl-1,3-thiazol-2-yl)-1-phenylaziridin-2-yl]-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 134998696) has the molecular formula C17H19N3OS and a molecular weight of 314.43 g/mol. Its IUPAC name is 2-[(3R)-2-deuterio-3-(4-methyl-1,3-thiazol-2-yl)-1-phenylaziridin-2-yl]-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2-[(3R)-2-deuterio-3-(4-methyl-1,3-thiazol-2-yl)-1-phenylaziridin-2-yl]-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 134998696 |
| Molecular Formula | C17H19N3OS |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 2-[(3R)-2-deuterio-3-(4-methyl-1,3-thiazol-2-yl)-1-phenylaziridin-2-yl]-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | [2H]C1(C2=NC(C)(C)CO2)[C@H](c2nc(C)cs2)N1c1ccccc1 |
| InChI | InChI=1S/C17H19N3OS/c1-11-9-22-16(18-11)14-13(15-19-17(2,3)10-21-15)20(14)12-7-5-4-6-8-12/h4-9,13-14H,10H2,1-3H3/t13?,14-,20?/m1/s1/i13D |
| InChIKey | IOICUKJBENUMKE-FNOJTALISA-N |
| XLogP | 3.59 |
| TPSA | 37.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|