C16H24O3 — CID 134998806
(3R,5S)-3,9-ditert-butyl-1,4-dioxaspiro[4.5]deca-7,9-dien-6-one (PubChem CID 134998806) has the molecular formula C16H24O3 and a molecular weight of 264.37 g/mol. Its IUPAC name is (3R,5S)-3,9-ditert-butyl-1,4-dioxaspiro[4.5]deca-7,9-dien-6-one.
| Compound Name | (3R,5S)-3,9-ditert-butyl-1,4-dioxaspiro[4.5]deca-7,9-dien-6-one |
|---|---|
| PubChem CID | 134998806 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (3R,5S)-3,9-ditert-butyl-1,4-dioxaspiro[4.5]deca-7,9-dien-6-one |
| SMILES | CC(C)(C)C1=C[C@@]2(OC[C@@H](C(C)(C)C)O2)C(=O)C=C1 |
| InChI | InChI=1S/C16H24O3/c1-14(2,3)11-7-8-12(17)16(9-11)18-10-13(19-16)15(4,5)6/h7-9,13H,10H2,1-6H3/t13-,16-/m0/s1 |
| InChIKey | LGUUXNDRTKZXLY-BBRMVZONSA-N |
| XLogP | 3.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |