C14H22O6 — CID 134998812
diethyl (5R)-1,6-dioxaspiro[4.5]decane-9,9-dicarboxylate (PubChem CID 134998812) has the molecular formula C14H22O6 and a molecular weight of 286.32 g/mol. Its IUPAC name is diethyl (5R)-1,6-dioxaspiro[4.5]decane-9,9-dicarboxylate.
| Compound Name | diethyl (5R)-1,6-dioxaspiro[4.5]decane-9,9-dicarboxylate |
|---|---|
| PubChem CID | 134998812 |
| Molecular Formula | C14H22O6 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | diethyl (5R)-1,6-dioxaspiro[4.5]decane-9,9-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CCO[C@]2(CCCO2)C1 |
| InChI | InChI=1S/C14H22O6/c1-3-17-11(15)13(12(16)18-4-2)7-9-20-14(10-13)6-5-8-19-14/h3-10H2,1-2H3/t14-/m1/s1 |
| InChIKey | OJUORBDAHVPHLM-CQSZACIVSA-N |
| XLogP | 1.42 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|