C18H27NO2 — CID 134998857
(2R)-2-ethyl-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N,2-dimethylpent-4-enamide (PubChem CID 134998857) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is (2R)-2-ethyl-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N,2-dimethylpent-4-enamide.
| Compound Name | (2R)-2-ethyl-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N,2-dimethylpent-4-enamide |
|---|---|
| PubChem CID | 134998857 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | (2R)-2-ethyl-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N,2-dimethylpent-4-enamide |
| SMILES | C=CC[C@@](C)(CC)C(=O)N(C)[C@@H](C)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C18H27NO2/c1-6-13-18(4,7-2)17(21)19(5)14(3)16(20)15-11-9-8-10-12-15/h6,8-12,14,16,20H,1,7,13H2,2-5H3/t14-,16+,18+/m0/s1 |
| InChIKey | QGUFJRAFSWTTSO-YXJHDRRASA-N |
| XLogP | 3.56 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|