C23H20O4 — CID 134998893
(3aR,6S,6aS)-6-ethylspiro[6,6a-dihydro-3aH-furo[3,4-b]furan-3,15'-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene]-2,4-dione (PubChem CID 134998893) has the molecular formula C23H20O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is (3aR,6S,6aS)-6-ethylspiro[6,6a-dihydro-3aH-furo[3,4-b]furan-3,15'-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene]-2,4-dione.
| Compound Name | (3aR,6S,6aS)-6-ethylspiro[6,6a-dihydro-3aH-furo[3,4-b]furan-3,15'-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene]-2,4-dione |
|---|---|
| PubChem CID | 134998893 |
| Molecular Formula | C23H20O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | (3aR,6S,6aS)-6-ethylspiro[6,6a-dihydro-3aH-furo[3,4-b]furan-3,15'-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene]-2,4-dione |
| SMILES | CC[C@@H]1OC(=O)[C@H]2[C@@H]1OC(=O)C21CC2c3ccccc3C1c1ccccc12 |
| InChI | InChI=1S/C23H20O4/c1-2-17-20-19(21(24)26-17)23(22(25)27-20)11-16-12-7-3-5-9-14(12)18(23)15-10-6-4-8-13(15)16/h3-10,16-20H,2,11H2,1H3/t16?,17-,18?,19+,20+,23?/m0/s1 |
| InChIKey | PKQPBODYSPQRQR-UHFGNNGLSA-N |
| XLogP | 3.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |