C34H59NO3Sn — CID 134998915
[(1R,2R)-4,4-dimethyl-2-[(R)-phenyl(tributylstannyl)methyl]cyclopentyl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 134998915) has the molecular formula C34H59NO3Sn and a molecular weight of 648.56 g/mol. Its IUPAC name is [(1R,2R)-4,4-dimethyl-2-[(R)-phenyl(tributylstannyl)methyl]cyclopentyl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | [(1R,2R)-4,4-dimethyl-2-[(R)-phenyl(tributylstannyl)methyl]cyclopentyl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 134998915 |
| Molecular Formula | C34H59NO3Sn |
| Molecular Weight | 648.56 g/mol |
| Exact Mass | 649.35 |
| IUPAC Name | [(1R,2R)-4,4-dimethyl-2-[(R)-phenyl(tributylstannyl)methyl]cyclopentyl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CCCC[Sn](CCCC)(CCCC)[C@@H](c1ccccc1)[C@@H]1CC(C)(C)C[C@H]1OC(=O)N1C(C)(C)COC1(C)C |
| InChI | InChI=1S/C22H32NO3.3C4H9.Sn/c1-20(2)13-17(12-16-10-8-7-9-11-16)18(14-20)26-19(24)23-21(3,4)15-25-22(23,5)6;3*1-3-4-2;/h7-12,17-18H,13-15H2,1-6H3;3*1,3-4H2,2H3;/t17-,18-;;;;/m1..../s1 |
| InChIKey | WOFORULNBZDTJG-VKBKZCJQSA-N |
| XLogP | 9.95 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.56 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |