C24H44O5 — CID 134998982
tert-butyl 3-[(2S,3S)-5-hydroxy-4,4,5-trimethyl-2-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxyoxolan-3-yl]propanoate (PubChem CID 134998982) has the molecular formula C24H44O5 and a molecular weight of 412.61 g/mol. Its IUPAC name is tert-butyl 3-[(2S,3S)-5-hydroxy-4,4,5-trimethyl-2-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxyoxolan-3-yl]propanoate.
| Compound Name | tert-butyl 3-[(2S,3S)-5-hydroxy-4,4,5-trimethyl-2-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxyoxolan-3-yl]propanoate |
|---|---|
| PubChem CID | 134998982 |
| Molecular Formula | C24H44O5 |
| Molecular Weight | 412.61 g/mol |
| Exact Mass | 412.32 |
| IUPAC Name | tert-butyl 3-[(2S,3S)-5-hydroxy-4,4,5-trimethyl-2-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxyoxolan-3-yl]propanoate |
| SMILES | CC(C)[C@H]1CC[C@H](C)C[C@@H]1O[C@H]1OC(C)(O)C(C)(C)[C@@H]1CCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H44O5/c1-15(2)17-11-10-16(3)14-19(17)27-21-18(23(7,8)24(9,26)29-21)12-13-20(25)28-22(4,5)6/h15-19,21,26H,10-14H2,1-9H3/t16-,17+,18+,19-,21-,24?/m0/s1 |
| InChIKey | MEZLKBNLHWISEI-AWFNZEBFSA-N |
| XLogP | 5.29 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.61 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |