C28H39NO3Si — CID 134999060
[(1R,2R)-2-[(R)-[dimethyl(phenyl)silyl]-phenylmethyl]cyclopentyl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 134999060) has the molecular formula C28H39NO3Si and a molecular weight of 465.71 g/mol. Its IUPAC name is [(1R,2R)-2-[(R)-[dimethyl(phenyl)silyl]-phenylmethyl]cyclopentyl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | [(1R,2R)-2-[(R)-[dimethyl(phenyl)silyl]-phenylmethyl]cyclopentyl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 134999060 |
| Molecular Formula | C28H39NO3Si |
| Molecular Weight | 465.71 g/mol |
| Exact Mass | 465.27 |
| IUPAC Name | [(1R,2R)-2-[(R)-[dimethyl(phenyl)silyl]-phenylmethyl]cyclopentyl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC1(C)COC(C)(C)N1C(=O)O[C@@H]1CCC[C@H]1[C@H](c1ccccc1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C28H39NO3Si/c1-27(2)20-31-28(3,4)29(27)26(30)32-24-19-13-18-23(24)25(21-14-9-7-10-15-21)33(5,6)22-16-11-8-12-17-22/h7-12,14-17,23-25H,13,18-20H2,1-6H3/t23-,24-,25+/m1/s1 |
| InChIKey | MPGOFRMHOGCUIV-SDHSZQHLSA-N |
| XLogP | 6.08 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.71 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|