C30H43NO3Si — CID 134999066
[(1R,2R)-2-[(R)-[dimethyl(phenyl)silyl]-phenylmethyl]-4,4-dimethylcyclopentyl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 134999066) has the molecular formula C30H43NO3Si and a molecular weight of 493.76 g/mol. Its IUPAC name is [(1R,2R)-2-[(R)-[dimethyl(phenyl)silyl]-phenylmethyl]-4,4-dimethylcyclopentyl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | [(1R,2R)-2-[(R)-[dimethyl(phenyl)silyl]-phenylmethyl]-4,4-dimethylcyclopentyl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 134999066 |
| Molecular Formula | C30H43NO3Si |
| Molecular Weight | 493.76 g/mol |
| Exact Mass | 493.30 |
| IUPAC Name | [(1R,2R)-2-[(R)-[dimethyl(phenyl)silyl]-phenylmethyl]-4,4-dimethylcyclopentyl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC1(C)C[C@@H]([C@H](c2ccccc2)[Si](C)(C)c2ccccc2)[C@H](OC(=O)N2C(C)(C)COC2(C)C)C1 |
| InChI | InChI=1S/C30H43NO3Si/c1-28(2)19-24(25(20-28)34-27(32)31-29(3,4)21-33-30(31,5)6)26(22-15-11-9-12-16-22)35(7,8)23-17-13-10-14-18-23/h9-18,24-26H,19-21H2,1-8H3/t24-,25-,26+/m1/s1 |
| InChIKey | VSINOEACFLIHRT-CYXNTTPDSA-N |
| XLogP | 6.71 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.76 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|