About (3-butyl-1H-isochromen-5-yl)methanol;carbon monoxide;chromium
(3-butyl-1H-isochromen-5-yl)methanol;carbon monoxide;chromium (PubChem CID 134999157) has the molecular formula C17H18CrO5
and a molecular weight of 354.32 g/mol. Its IUPAC name is (3-butyl-1H-isochromen-5-yl)methanol;carbon monoxide;chromium.
Molecular Properties
| Compound Name | (3-butyl-1H-isochromen-5-yl)methanol;carbon monoxide;chromium |
| PubChem CID | 134999157 |
| Molecular Formula | C17H18CrO5 |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | (3-butyl-1H-isochromen-5-yl)methanol;carbon monoxide;chromium |
| SMILES | CCCCC1=Cc2c(CO)cccc2CO1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr] |
| InChI | InChI=1S/C14H18O2.3CO.Cr/c1-2-3-7-13-8-14-11(9-15)5-4-6-12(14)10-16-13;3*1-2;/h4-6,8,15H,2-3,7,9-10H2,1H3;;;; |
| InChIKey | CHQKTPDEWFPQPF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 89.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze (3-butyl-1H-isochromen-5-yl)methanol;carbon monoxide;chromium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-butyl-1H-isochromen-5-yl)methanol;carbon monoxide;chromium?
The IUPAC name of (3-butyl-1H-isochromen-5-yl)methanol;carbon monoxide;chromium (CID 134999157) is (3-butyl-1H-isochromen-5-yl)methanol;carbon monoxide;chromium.
What is the SMILES notation for (3-butyl-1H-isochromen-5-yl)methanol;carbon monoxide;chromium?
The canonical SMILES for (3-butyl-1H-isochromen-5-yl)methanol;carbon monoxide;chromium is CCCCC1=Cc2c(CO)cccc2CO1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr].
What is the InChIKey of (3-butyl-1H-isochromen-5-yl)methanol;carbon monoxide;chromium?
The InChIKey is CHQKTPDEWFPQPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O2.3CO.Cr/c1-2-3-7-13-8-14-11(9-15)5-4-6-12(14)10-16-13;3*1-2;/h4-6,8,15H,2-3,7,9-10H2,1H3;;;;.
What are the key properties of (3-butyl-1H-isochromen-5-yl)methanol;carbon monoxide;chromium?
(3-butyl-1H-isochromen-5-yl)methanol;carbon monoxide;chromium has a molecular weight of 354.32 g/mol, XLogP of 3.13, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-butyl-1H-isochromen-5-yl)methanol;carbon monoxide;chromium is sourced from PubChem (CID 134999157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).