About (5R)-5-(hydroxymethyl)-1,4-diphenylpyrrolidin-2-one
(5R)-5-(hydroxymethyl)-1,4-diphenylpyrrolidin-2-one (PubChem CID 134999162) has the molecular formula C17H17NO2
and a molecular weight of 267.33 g/mol. Its IUPAC name is (5R)-5-(hydroxymethyl)-1,4-diphenylpyrrolidin-2-one.
Molecular Properties
| Compound Name | (5R)-5-(hydroxymethyl)-1,4-diphenylpyrrolidin-2-one |
| PubChem CID | 134999162 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | (5R)-5-(hydroxymethyl)-1,4-diphenylpyrrolidin-2-one |
| SMILES | O=C1CC(c2ccccc2)[C@H](CO)N1c1ccccc1 |
| InChI | InChI=1S/C17H17NO2/c19-12-16-15(13-7-3-1-4-8-13)11-17(20)18(16)14-9-5-2-6-10-14/h1-10,15-16,19H,11-12H2/t15?,16-/m0/s1 |
| InChIKey | XACXVNWIPLFFBM-LYKKTTPLSA-N |
| XLogP | 2.57 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5R)-5-(hydroxymethyl)-1,4-diphenylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-(hydroxymethyl)-1,4-diphenylpyrrolidin-2-one?
The IUPAC name of (5R)-5-(hydroxymethyl)-1,4-diphenylpyrrolidin-2-one (CID 134999162) is (5R)-5-(hydroxymethyl)-1,4-diphenylpyrrolidin-2-one.
What is the SMILES notation for (5R)-5-(hydroxymethyl)-1,4-diphenylpyrrolidin-2-one?
The canonical SMILES for (5R)-5-(hydroxymethyl)-1,4-diphenylpyrrolidin-2-one is O=C1CC(c2ccccc2)[C@H](CO)N1c1ccccc1.
What is the InChIKey of (5R)-5-(hydroxymethyl)-1,4-diphenylpyrrolidin-2-one?
The InChIKey is XACXVNWIPLFFBM-LYKKTTPLSA-N. The full InChI is InChI=1S/C17H17NO2/c19-12-16-15(13-7-3-1-4-8-13)11-17(20)18(16)14-9-5-2-6-10-14/h1-10,15-16,19H,11-12H2/t15?,16-/m0/s1.
What are the key properties of (5R)-5-(hydroxymethyl)-1,4-diphenylpyrrolidin-2-one?
(5R)-5-(hydroxymethyl)-1,4-diphenylpyrrolidin-2-one has a molecular weight of 267.33 g/mol, XLogP of 2.57, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-(hydroxymethyl)-1,4-diphenylpyrrolidin-2-one is sourced from PubChem (CID 134999162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).