C45H52O18 — CID 134999173
methyl 6-[[6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-2-oxo-4-[(1R,2R)-1,2,3-triacetyloxypropyl]-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-carboxylate (PubChem CID 134999173) has the molecular formula C45H52O18 and a molecular weight of 880.89 g/mol. Its IUPAC name is methyl 6-[[6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-2-oxo-4-[(1R,2R)-1,2,3-triacetyloxypropyl]-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-carboxylate.
| Compound Name | methyl 6-[[6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-2-oxo-4-[(1R,2R)-1,2,3-triacetyloxypropyl]-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-carboxylate |
|---|---|
| PubChem CID | 134999173 |
| Molecular Formula | C45H52O18 |
| Molecular Weight | 880.89 g/mol |
| Exact Mass | 880.32 |
| IUPAC Name | methyl 6-[[6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-2-oxo-4-[(1R,2R)-1,2,3-triacetyloxypropyl]-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-carboxylate |
| SMILES | COC(=O)C1(OCC2OC(OC)C(OCc3ccccc3)C(OCc3ccccc3)C2OCc2ccccc2)CC2OC(=O)OC2C([C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C45H52O18/c1-27(46)53-25-34(58-28(2)47)38(59-29(3)48)40-37-33(61-44(50)62-37)21-45(63-40,43(49)52-5)57-26-35-36(54-22-30-15-9-6-10-16-30)39(55-23-31-17-11-7-12-18-31)41(42(51-4)60-35)56-24-32-19-13-8-14-20-32/h6-20,33-42H,21-26H2,1-5H3/t33?,34-,35?,36?,37?,38-,39?,40?,41?,42?,45?/m1/s1 |
| InChIKey | YDTFLIRDQWWECE-AUZJJUQESA-N |
| XLogP | 4.12 |
| TPSA | 205.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 880.89 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|