C24H22BF2NO4 — CID 134999208
[4-[(2R)-1-(4-fluorophenyl)-3-[3-(4-fluorophenyl)-3-hydroxypropyl]-4-oxoazetidin-2-yl]phenyl]boronic acid (PubChem CID 134999208) has the molecular formula C24H22BF2NO4 and a molecular weight of 437.25 g/mol. Its IUPAC name is [4-[(2R)-1-(4-fluorophenyl)-3-[3-(4-fluorophenyl)-3-hydroxypropyl]-4-oxoazetidin-2-yl]phenyl]boronic acid.
| Compound Name | [4-[(2R)-1-(4-fluorophenyl)-3-[3-(4-fluorophenyl)-3-hydroxypropyl]-4-oxoazetidin-2-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 134999208 |
| Molecular Formula | C24H22BF2NO4 |
| Molecular Weight | 437.25 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | [4-[(2R)-1-(4-fluorophenyl)-3-[3-(4-fluorophenyl)-3-hydroxypropyl]-4-oxoazetidin-2-yl]phenyl]boronic acid |
| SMILES | O=C1C(CCC(O)c2ccc(F)cc2)[C@H](c2ccc(B(O)O)cc2)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C24H22BF2NO4/c26-18-7-3-15(4-8-18)22(29)14-13-21-23(16-1-5-17(6-2-16)25(31)32)28(24(21)30)20-11-9-19(27)10-12-20/h1-12,21-23,29,31-32H,13-14H2/t21?,22?,23-/m0/s1 |
| InChIKey | NUJZSISORIVUSV-VNXZQDSDSA-N |
| XLogP | 2.86 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.25 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|