C15H30O2Si — CID 134999428
(3R,4E,6E)-8-[tert-butyl(dimethyl)silyl]oxy-2-methylocta-4,6-dien-3-ol (PubChem CID 134999428) has the molecular formula C15H30O2Si and a molecular weight of 270.49 g/mol. Its IUPAC name is (3R,4E,6E)-8-[tert-butyl(dimethyl)silyl]oxy-2-methylocta-4,6-dien-3-ol.
| Compound Name | (3R,4E,6E)-8-[tert-butyl(dimethyl)silyl]oxy-2-methylocta-4,6-dien-3-ol |
|---|---|
| PubChem CID | 134999428 |
| Molecular Formula | C15H30O2Si |
| Molecular Weight | 270.49 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | (3R,4E,6E)-8-[tert-butyl(dimethyl)silyl]oxy-2-methylocta-4,6-dien-3-ol |
| SMILES | CC(C)[C@@H](O)/C=C/C=C/CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H30O2Si/c1-13(2)14(16)11-9-8-10-12-17-18(6,7)15(3,4)5/h8-11,13-14,16H,12H2,1-7H3/b10-8+,11-9+/t14-/m0/s1 |
| InChIKey | PVTGOGBTASPRGA-MBEFXWHISA-N |
| XLogP | 4.14 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|