C16H30O2Si — CID 134999538
(4R,7S)-2,2-di(propan-2-yl)-4-[(E)-prop-1-enyl]-7-propyl-4,7-dihydro-1,3,2-dioxasilepine (PubChem CID 134999538) has the molecular formula C16H30O2Si and a molecular weight of 282.50 g/mol. Its IUPAC name is (4R,7S)-2,2-di(propan-2-yl)-4-[(E)-prop-1-enyl]-7-propyl-4,7-dihydro-1,3,2-dioxasilepine.
| Compound Name | (4R,7S)-2,2-di(propan-2-yl)-4-[(E)-prop-1-enyl]-7-propyl-4,7-dihydro-1,3,2-dioxasilepine |
|---|---|
| PubChem CID | 134999538 |
| Molecular Formula | C16H30O2Si |
| Molecular Weight | 282.50 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | (4R,7S)-2,2-di(propan-2-yl)-4-[(E)-prop-1-enyl]-7-propyl-4,7-dihydro-1,3,2-dioxasilepine |
| SMILES | C/C=C/[C@@H]1C=C[C@H](CCC)O[Si](C(C)C)(C(C)C)O1 |
| InChI | InChI=1S/C16H30O2Si/c1-7-9-15-11-12-16(10-8-2)18-19(17-15,13(3)4)14(5)6/h7,9,11-16H,8,10H2,1-6H3/b9-7+/t15-,16+/m1/s1 |
| InChIKey | SEXAFLRWHFNNGZ-FEPMCFLQSA-N |
| XLogP | 4.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.50 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|