About (E)-7-[dimethyl(phenyl)silyl]-N,N-diethylhept-6-enamide
(E)-7-[dimethyl(phenyl)silyl]-N,N-diethylhept-6-enamide (PubChem CID 134999553) has the molecular formula C19H31NOSi
and a molecular weight of 317.55 g/mol. Its IUPAC name is (E)-7-[dimethyl(phenyl)silyl]-N,N-diethylhept-6-enamide.
Molecular Properties
| Compound Name | (E)-7-[dimethyl(phenyl)silyl]-N,N-diethylhept-6-enamide |
| PubChem CID | 134999553 |
| Molecular Formula | C19H31NOSi |
| Molecular Weight | 317.55 g/mol |
| Exact Mass | 317.22 |
| IUPAC Name | (E)-7-[dimethyl(phenyl)silyl]-N,N-diethylhept-6-enamide |
| SMILES | CCN(CC)C(=O)CCCC/C=C/[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C19H31NOSi/c1-5-20(6-2)19(21)16-12-7-8-13-17-22(3,4)18-14-10-9-11-15-18/h9-11,13-15,17H,5-8,12,16H2,1-4H3/b17-13+ |
| InChIKey | WUGZPNBBQWTRDQ-GHRIWEEISA-N |
| XLogP | 4.13 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.55 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (E)-7-[dimethyl(phenyl)silyl]-N,N-diethylhept-6-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-7-[dimethyl(phenyl)silyl]-N,N-diethylhept-6-enamide?
The IUPAC name of (E)-7-[dimethyl(phenyl)silyl]-N,N-diethylhept-6-enamide (CID 134999553) is (E)-7-[dimethyl(phenyl)silyl]-N,N-diethylhept-6-enamide.
What is the SMILES notation for (E)-7-[dimethyl(phenyl)silyl]-N,N-diethylhept-6-enamide?
The canonical SMILES for (E)-7-[dimethyl(phenyl)silyl]-N,N-diethylhept-6-enamide is CCN(CC)C(=O)CCCC/C=C/[Si](C)(C)c1ccccc1.
What is the InChIKey of (E)-7-[dimethyl(phenyl)silyl]-N,N-diethylhept-6-enamide?
The InChIKey is WUGZPNBBQWTRDQ-GHRIWEEISA-N. The full InChI is InChI=1S/C19H31NOSi/c1-5-20(6-2)19(21)16-12-7-8-13-17-22(3,4)18-14-10-9-11-15-18/h9-11,13-15,17H,5-8,12,16H2,1-4H3/b17-13+.
What are the key properties of (E)-7-[dimethyl(phenyl)silyl]-N,N-diethylhept-6-enamide?
(E)-7-[dimethyl(phenyl)silyl]-N,N-diethylhept-6-enamide has a molecular weight of 317.55 g/mol, XLogP of 4.13, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-7-[dimethyl(phenyl)silyl]-N,N-diethylhept-6-enamide is sourced from PubChem (CID 134999553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).