C29H33BO2Si — CID 134999569
methyl-diphenyl-[3-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclobut-2-en-1-yl]silane (PubChem CID 134999569) has the molecular formula C29H33BO2Si and a molecular weight of 452.48 g/mol. Its IUPAC name is methyl-diphenyl-[3-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclobut-2-en-1-yl]silane.
| Compound Name | methyl-diphenyl-[3-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclobut-2-en-1-yl]silane |
|---|---|
| PubChem CID | 134999569 |
| Molecular Formula | C29H33BO2Si |
| Molecular Weight | 452.48 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | methyl-diphenyl-[3-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclobut-2-en-1-yl]silane |
| SMILES | CC1(C)OB(C2([Si](C)(c3ccccc3)c3ccccc3)C=C(c3ccccc3)C2)OC1(C)C |
| InChI | InChI=1S/C29H33BO2Si/c1-27(2)28(3,4)32-30(31-27)29(21-24(22-29)23-15-9-6-10-16-23)33(5,25-17-11-7-12-18-25)26-19-13-8-14-20-26/h6-21H,22H2,1-5H3 |
| InChIKey | DBDFTKNWRONYDO-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.48 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|