About (E)-1-cyclohexyl-N,2-dipropylhex-2-en-1-amine
(E)-1-cyclohexyl-N,2-dipropylhex-2-en-1-amine (PubChem CID 134999587) has the molecular formula C18H35N
and a molecular weight of 265.48 g/mol. Its IUPAC name is (E)-1-cyclohexyl-N,2-dipropylhex-2-en-1-amine.
Molecular Properties
| Compound Name | (E)-1-cyclohexyl-N,2-dipropylhex-2-en-1-amine |
| PubChem CID | 134999587 |
| Molecular Formula | C18H35N |
| Molecular Weight | 265.48 g/mol |
| Exact Mass | 265.28 |
| IUPAC Name | (E)-1-cyclohexyl-N,2-dipropylhex-2-en-1-amine |
| SMILES | CCC/C=C(\CCC)C(NCCC)C1CCCCC1 |
| InChI | InChI=1S/C18H35N/c1-4-7-12-16(11-5-2)18(19-15-6-3)17-13-9-8-10-14-17/h12,17-19H,4-11,13-15H2,1-3H3/b16-12+ |
| InChIKey | HEXFPZYEHSWAFJ-FOWTUZBSSA-N |
| XLogP | 5.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 265.48 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-cyclohexyl-N,2-dipropylhex-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-cyclohexyl-N,2-dipropylhex-2-en-1-amine?
The IUPAC name of (E)-1-cyclohexyl-N,2-dipropylhex-2-en-1-amine (CID 134999587) is (E)-1-cyclohexyl-N,2-dipropylhex-2-en-1-amine.
What is the SMILES notation for (E)-1-cyclohexyl-N,2-dipropylhex-2-en-1-amine?
The canonical SMILES for (E)-1-cyclohexyl-N,2-dipropylhex-2-en-1-amine is CCC/C=C(\CCC)C(NCCC)C1CCCCC1.
What is the InChIKey of (E)-1-cyclohexyl-N,2-dipropylhex-2-en-1-amine?
The InChIKey is HEXFPZYEHSWAFJ-FOWTUZBSSA-N. The full InChI is InChI=1S/C18H35N/c1-4-7-12-16(11-5-2)18(19-15-6-3)17-13-9-8-10-14-17/h12,17-19H,4-11,13-15H2,1-3H3/b16-12+.
What are the key properties of (E)-1-cyclohexyl-N,2-dipropylhex-2-en-1-amine?
(E)-1-cyclohexyl-N,2-dipropylhex-2-en-1-amine has a molecular weight of 265.48 g/mol, XLogP of 5.46, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-cyclohexyl-N,2-dipropylhex-2-en-1-amine is sourced from PubChem (CID 134999587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).