C17H26N2O6 — CID 134999620
N-[(1S,2S)-1-[(2S)-1,1-diethoxy-3-nitropropan-2-yl]oxy-1-phenylpropan-2-yl]formamide (PubChem CID 134999620) has the molecular formula C17H26N2O6 and a molecular weight of 354.40 g/mol. Its IUPAC name is N-[(1S,2S)-1-[(2S)-1,1-diethoxy-3-nitropropan-2-yl]oxy-1-phenylpropan-2-yl]formamide.
| Compound Name | N-[(1S,2S)-1-[(2S)-1,1-diethoxy-3-nitropropan-2-yl]oxy-1-phenylpropan-2-yl]formamide |
|---|---|
| PubChem CID | 134999620 |
| Molecular Formula | C17H26N2O6 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | N-[(1S,2S)-1-[(2S)-1,1-diethoxy-3-nitropropan-2-yl]oxy-1-phenylpropan-2-yl]formamide |
| SMILES | CCOC(OCC)[C@H](C[N+](=O)[O-])O[C@@H](c1ccccc1)[C@H](C)NC=O |
| InChI | InChI=1S/C17H26N2O6/c1-4-23-17(24-5-2)15(11-19(21)22)25-16(13(3)18-12-20)14-9-7-6-8-10-14/h6-10,12-13,15-17H,4-5,11H2,1-3H3,(H,18,20)/t13-,15-,16+/m0/s1 |
| InChIKey | FSYJZVPYLXWTQP-CWRNSKLLSA-N |
| XLogP | 1.92 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|