C10H15F3O3 — CID 134999621
1-[(2S,3R)-3-cyclohexyloxiran-2-yl]-2,2,2-trifluoroethane-1,1-diol (PubChem CID 134999621) has the molecular formula C10H15F3O3 and a molecular weight of 240.22 g/mol. Its IUPAC name is 1-[(2S,3R)-3-cyclohexyloxiran-2-yl]-2,2,2-trifluoroethane-1,1-diol.
| Compound Name | 1-[(2S,3R)-3-cyclohexyloxiran-2-yl]-2,2,2-trifluoroethane-1,1-diol |
|---|---|
| PubChem CID | 134999621 |
| Molecular Formula | C10H15F3O3 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 1-[(2S,3R)-3-cyclohexyloxiran-2-yl]-2,2,2-trifluoroethane-1,1-diol |
| SMILES | OC(O)([C@H]1O[C@@H]1C1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C10H15F3O3/c11-10(12,13)9(14,15)8-7(16-8)6-4-2-1-3-5-6/h6-8,14-15H,1-5H2/t7-,8+/m1/s1 |
| InChIKey | YWUDTESAJRMRRP-SFYZADRCSA-N |
| XLogP | 1.58 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|