C12H18O3 — CID 134999705
methyl 2-[(3aR,7aS)-3-oxo-2,4,5,6,7,7a-hexahydro-1H-inden-3a-yl]acetate (PubChem CID 134999705) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is methyl 2-[(3aR,7aS)-3-oxo-2,4,5,6,7,7a-hexahydro-1H-inden-3a-yl]acetate.
| Compound Name | methyl 2-[(3aR,7aS)-3-oxo-2,4,5,6,7,7a-hexahydro-1H-inden-3a-yl]acetate |
|---|---|
| PubChem CID | 134999705 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | methyl 2-[(3aR,7aS)-3-oxo-2,4,5,6,7,7a-hexahydro-1H-inden-3a-yl]acetate |
| SMILES | COC(=O)C[C@]12CCCC[C@H]1CCC2=O |
| InChI | InChI=1S/C12H18O3/c1-15-11(14)8-12-7-3-2-4-9(12)5-6-10(12)13/h9H,2-8H2,1H3/t9-,12+/m0/s1 |
| InChIKey | QVCVLUIJSOPNRC-JOYOIKCWSA-N |
| XLogP | 2.09 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |