About ethyl 9a-bromo-5-methoxy-4,9-dioxo-3aH-benzo[f][1,2]benzoxazole-3-carboxylate
ethyl 9a-bromo-5-methoxy-4,9-dioxo-3aH-benzo[f][1,2]benzoxazole-3-carboxylate (PubChem CID 134999871) has the molecular formula C15H12BrNO6
and a molecular weight of 382.17 g/mol. Its IUPAC name is ethyl 9a-bromo-5-methoxy-4,9-dioxo-3aH-benzo[f][1,2]benzoxazole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 9a-bromo-5-methoxy-4,9-dioxo-3aH-benzo[f][1,2]benzoxazole-3-carboxylate |
| PubChem CID | 134999871 |
| Molecular Formula | C15H12BrNO6 |
| Molecular Weight | 382.17 g/mol |
| Exact Mass | 380.98 |
| IUPAC Name | ethyl 9a-bromo-5-methoxy-4,9-dioxo-3aH-benzo[f][1,2]benzoxazole-3-carboxylate |
| SMILES | CCOC(=O)C1=NOC2(Br)C(=O)c3cccc(OC)c3C(=O)C12 |
| InChI | InChI=1S/C15H12BrNO6/c1-3-22-14(20)11-10-12(18)9-7(5-4-6-8(9)21-2)13(19)15(10,16)23-17-11/h4-6,10H,3H2,1-2H3 |
| InChIKey | JXIDMDFWYGQOFO-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 91.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.17 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze ethyl 9a-bromo-5-methoxy-4,9-dioxo-3aH-benzo[f][1,2]benzoxazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 9a-bromo-5-methoxy-4,9-dioxo-3aH-benzo[f][1,2]benzoxazole-3-carboxylate?
The IUPAC name of ethyl 9a-bromo-5-methoxy-4,9-dioxo-3aH-benzo[f][1,2]benzoxazole-3-carboxylate (CID 134999871) is ethyl 9a-bromo-5-methoxy-4,9-dioxo-3aH-benzo[f][1,2]benzoxazole-3-carboxylate.
What is the SMILES notation for ethyl 9a-bromo-5-methoxy-4,9-dioxo-3aH-benzo[f][1,2]benzoxazole-3-carboxylate?
The canonical SMILES for ethyl 9a-bromo-5-methoxy-4,9-dioxo-3aH-benzo[f][1,2]benzoxazole-3-carboxylate is CCOC(=O)C1=NOC2(Br)C(=O)c3cccc(OC)c3C(=O)C12.
What is the InChIKey of ethyl 9a-bromo-5-methoxy-4,9-dioxo-3aH-benzo[f][1,2]benzoxazole-3-carboxylate?
The InChIKey is JXIDMDFWYGQOFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12BrNO6/c1-3-22-14(20)11-10-12(18)9-7(5-4-6-8(9)21-2)13(19)15(10,16)23-17-11/h4-6,10H,3H2,1-2H3.
What are the key properties of ethyl 9a-bromo-5-methoxy-4,9-dioxo-3aH-benzo[f][1,2]benzoxazole-3-carboxylate?
ethyl 9a-bromo-5-methoxy-4,9-dioxo-3aH-benzo[f][1,2]benzoxazole-3-carboxylate has a molecular weight of 382.17 g/mol, XLogP of 1.73, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 9a-bromo-5-methoxy-4,9-dioxo-3aH-benzo[f][1,2]benzoxazole-3-carboxylate is sourced from PubChem (CID 134999871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).