About [3-(2,4-dimethoxypyrimidin-5-yl)-1,2-oxazol-5-yl]methyl benzoate
[3-(2,4-dimethoxypyrimidin-5-yl)-1,2-oxazol-5-yl]methyl benzoate (PubChem CID 135000044) has the molecular formula C17H15N3O5
and a molecular weight of 341.32 g/mol. Its IUPAC name is [3-(2,4-dimethoxypyrimidin-5-yl)-1,2-oxazol-5-yl]methyl benzoate.
Molecular Properties
| Compound Name | [3-(2,4-dimethoxypyrimidin-5-yl)-1,2-oxazol-5-yl]methyl benzoate |
| PubChem CID | 135000044 |
| Molecular Formula | C17H15N3O5 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | [3-(2,4-dimethoxypyrimidin-5-yl)-1,2-oxazol-5-yl]methyl benzoate |
| SMILES | COc1ncc(-c2cc(COC(=O)c3ccccc3)on2)c(OC)n1 |
| InChI | InChI=1S/C17H15N3O5/c1-22-15-13(9-18-17(19-15)23-2)14-8-12(25-20-14)10-24-16(21)11-6-4-3-5-7-11/h3-9H,10H2,1-2H3 |
| InChIKey | CQYGCBBVSYXPEL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 96.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze [3-(2,4-dimethoxypyrimidin-5-yl)-1,2-oxazol-5-yl]methyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2,4-dimethoxypyrimidin-5-yl)-1,2-oxazol-5-yl]methyl benzoate?
The IUPAC name of [3-(2,4-dimethoxypyrimidin-5-yl)-1,2-oxazol-5-yl]methyl benzoate (CID 135000044) is [3-(2,4-dimethoxypyrimidin-5-yl)-1,2-oxazol-5-yl]methyl benzoate.
What is the SMILES notation for [3-(2,4-dimethoxypyrimidin-5-yl)-1,2-oxazol-5-yl]methyl benzoate?
The canonical SMILES for [3-(2,4-dimethoxypyrimidin-5-yl)-1,2-oxazol-5-yl]methyl benzoate is COc1ncc(-c2cc(COC(=O)c3ccccc3)on2)c(OC)n1.
What is the InChIKey of [3-(2,4-dimethoxypyrimidin-5-yl)-1,2-oxazol-5-yl]methyl benzoate?
The InChIKey is CQYGCBBVSYXPEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N3O5/c1-22-15-13(9-18-17(19-15)23-2)14-8-12(25-20-14)10-24-16(21)11-6-4-3-5-7-11/h3-9H,10H2,1-2H3.
What are the key properties of [3-(2,4-dimethoxypyrimidin-5-yl)-1,2-oxazol-5-yl]methyl benzoate?
[3-(2,4-dimethoxypyrimidin-5-yl)-1,2-oxazol-5-yl]methyl benzoate has a molecular weight of 341.32 g/mol, XLogP of 2.51, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2,4-dimethoxypyrimidin-5-yl)-1,2-oxazol-5-yl]methyl benzoate is sourced from PubChem (CID 135000044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).