C26H34O10 — CID 135000876
2-O,2-O',7-O,7-O'-tetraethyl 4-O-methyl 1,3,5,5a,6,8-hexahydro-as-indacene-2,2,4,7,7-pentacarboxylate (PubChem CID 135000876) has the molecular formula C26H34O10 and a molecular weight of 506.55 g/mol. Its IUPAC name is 2-O,2-O',7-O,7-O'-tetraethyl 4-O-methyl 1,3,5,5a,6,8-hexahydro-as-indacene-2,2,4,7,7-pentacarboxylate.
| Compound Name | 2-O,2-O',7-O,7-O'-tetraethyl 4-O-methyl 1,3,5,5a,6,8-hexahydro-as-indacene-2,2,4,7,7-pentacarboxylate |
|---|---|
| PubChem CID | 135000876 |
| Molecular Formula | C26H34O10 |
| Molecular Weight | 506.55 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | 2-O,2-O',7-O,7-O'-tetraethyl 4-O-methyl 1,3,5,5a,6,8-hexahydro-as-indacene-2,2,4,7,7-pentacarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC2=C(C(=O)OC)CC3CC(C(=O)OCC)(C(=O)OCC)CC3=C2C1 |
| InChI | InChI=1S/C26H34O10/c1-6-33-21(28)25(22(29)34-7-2)11-15-10-16(20(27)32-5)18-13-26(23(30)35-8-3,24(31)36-9-4)14-19(18)17(15)12-25/h15H,6-14H2,1-5H3 |
| InChIKey | PFSRCTFGNDXFII-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.55 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|