About ethyl (4R)-4-(1-methyl-4,7-dihydroindol-2-yl)-4-(3-nitrophenyl)-2-oxobutanoate
ethyl (4R)-4-(1-methyl-4,7-dihydroindol-2-yl)-4-(3-nitrophenyl)-2-oxobutanoate (PubChem CID 135000918) has the molecular formula C21H22N2O5
and a molecular weight of 382.42 g/mol. Its IUPAC name is ethyl (4R)-4-(1-methyl-4,7-dihydroindol-2-yl)-4-(3-nitrophenyl)-2-oxobutanoate.
Molecular Properties
| Compound Name | ethyl (4R)-4-(1-methyl-4,7-dihydroindol-2-yl)-4-(3-nitrophenyl)-2-oxobutanoate |
| PubChem CID | 135000918 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | ethyl (4R)-4-(1-methyl-4,7-dihydroindol-2-yl)-4-(3-nitrophenyl)-2-oxobutanoate |
| SMILES | CCOC(=O)C(=O)C[C@H](c1cccc([N+](=O)[O-])c1)c1cc2c(n1C)CC=CC2 |
| InChI | InChI=1S/C21H22N2O5/c1-3-28-21(25)20(24)13-17(14-8-6-9-16(11-14)23(26)27)19-12-15-7-4-5-10-18(15)22(19)2/h4-6,8-9,11-12,17H,3,7,10,13H2,1-2H3/t17-/m1/s1 |
| InChIKey | LNTNJPJYYZQKMP-QGZVFWFLSA-N |
| XLogP | 3.24 |
| TPSA | 91.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl (4R)-4-(1-methyl-4,7-dihydroindol-2-yl)-4-(3-nitrophenyl)-2-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (4R)-4-(1-methyl-4,7-dihydroindol-2-yl)-4-(3-nitrophenyl)-2-oxobutanoate?
The IUPAC name of ethyl (4R)-4-(1-methyl-4,7-dihydroindol-2-yl)-4-(3-nitrophenyl)-2-oxobutanoate (CID 135000918) is ethyl (4R)-4-(1-methyl-4,7-dihydroindol-2-yl)-4-(3-nitrophenyl)-2-oxobutanoate.
What is the SMILES notation for ethyl (4R)-4-(1-methyl-4,7-dihydroindol-2-yl)-4-(3-nitrophenyl)-2-oxobutanoate?
The canonical SMILES for ethyl (4R)-4-(1-methyl-4,7-dihydroindol-2-yl)-4-(3-nitrophenyl)-2-oxobutanoate is CCOC(=O)C(=O)C[C@H](c1cccc([N+](=O)[O-])c1)c1cc2c(n1C)CC=CC2.
What is the InChIKey of ethyl (4R)-4-(1-methyl-4,7-dihydroindol-2-yl)-4-(3-nitrophenyl)-2-oxobutanoate?
The InChIKey is LNTNJPJYYZQKMP-QGZVFWFLSA-N. The full InChI is InChI=1S/C21H22N2O5/c1-3-28-21(25)20(24)13-17(14-8-6-9-16(11-14)23(26)27)19-12-15-7-4-5-10-18(15)22(19)2/h4-6,8-9,11-12,17H,3,7,10,13H2,1-2H3/t17-/m1/s1.
What are the key properties of ethyl (4R)-4-(1-methyl-4,7-dihydroindol-2-yl)-4-(3-nitrophenyl)-2-oxobutanoate?
ethyl (4R)-4-(1-methyl-4,7-dihydroindol-2-yl)-4-(3-nitrophenyl)-2-oxobutanoate has a molecular weight of 382.42 g/mol, XLogP of 3.24, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (4R)-4-(1-methyl-4,7-dihydroindol-2-yl)-4-(3-nitrophenyl)-2-oxobutanoate is sourced from PubChem (CID 135000918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).