C21H19NO5 — CID 135000928
(3S,3'S)-1-prop-2-ynyl-3'-(3,4,5-trimethoxyphenyl)spiro[indole-3,2'-oxirane]-2-one (PubChem CID 135000928) has the molecular formula C21H19NO5 and a molecular weight of 365.39 g/mol. Its IUPAC name is (3S,3'S)-1-prop-2-ynyl-3'-(3,4,5-trimethoxyphenyl)spiro[indole-3,2'-oxirane]-2-one.
| Compound Name | (3S,3'S)-1-prop-2-ynyl-3'-(3,4,5-trimethoxyphenyl)spiro[indole-3,2'-oxirane]-2-one |
|---|---|
| PubChem CID | 135000928 |
| Molecular Formula | C21H19NO5 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | (3S,3'S)-1-prop-2-ynyl-3'-(3,4,5-trimethoxyphenyl)spiro[indole-3,2'-oxirane]-2-one |
| SMILES | C#CCN1C(=O)[C@]2(O[C@H]2c2cc(OC)c(OC)c(OC)c2)c2ccccc21 |
| InChI | InChI=1S/C21H19NO5/c1-5-10-22-15-9-7-6-8-14(15)21(20(22)23)19(27-21)13-11-16(24-2)18(26-4)17(12-13)25-3/h1,6-9,11-12,19H,10H2,2-4H3/t19-,21-/m0/s1 |
| InChIKey | AMBHIFPJVDZVLX-FPOVZHCZSA-N |
| XLogP | 2.66 |
| TPSA | 60.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|