C22H48SiSn — CID 135001085
[(E)-4,4-dimethyl-1-tributylstannylpent-2-en-2-yl]-trimethylsilane (PubChem CID 135001085) has the molecular formula C22H48SiSn and a molecular weight of 459.42 g/mol. Its IUPAC name is [(E)-4,4-dimethyl-1-tributylstannylpent-2-en-2-yl]-trimethylsilane.
| Compound Name | [(E)-4,4-dimethyl-1-tributylstannylpent-2-en-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 135001085 |
| Molecular Formula | C22H48SiSn |
| Molecular Weight | 459.42 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | [(E)-4,4-dimethyl-1-tributylstannylpent-2-en-2-yl]-trimethylsilane |
| SMILES | CCCC[Sn](CCCC)(CCCC)C/C(=C\C(C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C10H21Si.3C4H9.Sn/c1-9(11(5,6)7)8-10(2,3)4;3*1-3-4-2;/h8H,1H2,2-7H3;3*1,3-4H2,2H3;/b9-8+;;;; |
| InChIKey | UEDFLPYNOQUSBS-HUMMXKGPSA-N |
| XLogP | 8.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.42 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|