C10H12F6N2S — CID 135001092
5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-4-methyl-N-propan-2-yl-1,3-thiazol-2-amine (PubChem CID 135001092) has the molecular formula C10H12F6N2S and a molecular weight of 306.28 g/mol. Its IUPAC name is 5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-4-methyl-N-propan-2-yl-1,3-thiazol-2-amine.
| Compound Name | 5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-4-methyl-N-propan-2-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 135001092 |
| Molecular Formula | C10H12F6N2S |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-4-methyl-N-propan-2-yl-1,3-thiazol-2-amine |
| SMILES | Cc1nc(NC(C)C)sc1C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H12F6N2S/c1-4(2)17-8-18-5(3)6(19-8)7(9(11,12)13)10(14,15)16/h4,7H,1-3H3,(H,17,18) |
| InChIKey | YRXWWCIDVWIAFM-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |