C24H37NO2Si — CID 135001152
(2R,3S)-4-[tert-butyl(dimethyl)silyl]oxy-3-(dibenzylamino)butan-2-ol (PubChem CID 135001152) has the molecular formula C24H37NO2Si and a molecular weight of 399.65 g/mol. Its IUPAC name is (2R,3S)-4-[tert-butyl(dimethyl)silyl]oxy-3-(dibenzylamino)butan-2-ol.
| Compound Name | (2R,3S)-4-[tert-butyl(dimethyl)silyl]oxy-3-(dibenzylamino)butan-2-ol |
|---|---|
| PubChem CID | 135001152 |
| Molecular Formula | C24H37NO2Si |
| Molecular Weight | 399.65 g/mol |
| Exact Mass | 399.26 |
| IUPAC Name | (2R,3S)-4-[tert-butyl(dimethyl)silyl]oxy-3-(dibenzylamino)butan-2-ol |
| SMILES | C[C@@H](O)[C@H](CO[Si](C)(C)C(C)(C)C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H37NO2Si/c1-20(26)23(19-27-28(5,6)24(2,3)4)25(17-21-13-9-7-10-14-21)18-22-15-11-8-12-16-22/h7-16,20,23,26H,17-19H2,1-6H3/t20-,23+/m1/s1 |
| InChIKey | XLKXMAXYDLHMOW-OFNKIYASSA-N |
| XLogP | 5.46 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.65 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|