C11H18BrF3INO — CID 135001197
2-bromo-N,N-dibutyl-3,3,3-trifluoro-2-iodopropanamide (PubChem CID 135001197) has the molecular formula C11H18BrF3INO and a molecular weight of 444.07 g/mol. Its IUPAC name is 2-bromo-N,N-dibutyl-3,3,3-trifluoro-2-iodopropanamide.
| Compound Name | 2-bromo-N,N-dibutyl-3,3,3-trifluoro-2-iodopropanamide |
|---|---|
| PubChem CID | 135001197 |
| Molecular Formula | C11H18BrF3INO |
| Molecular Weight | 444.07 g/mol |
| Exact Mass | 442.96 |
| IUPAC Name | 2-bromo-N,N-dibutyl-3,3,3-trifluoro-2-iodopropanamide |
| SMILES | CCCCN(CCCC)C(=O)C(Br)(I)C(F)(F)F |
| InChI | InChI=1S/C11H18BrF3INO/c1-3-5-7-17(8-6-4-2)9(18)10(12,16)11(13,14)15/h3-8H2,1-2H3 |
| InChIKey | ARNCEFVQMFSMDT-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.07 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|