C23H35NO8 — CID 135001484
tert-butyl (4R)-4-[(1S,2R,3R)-4-ethoxy-2,3-dihydroxy-4-oxo-1-phenylmethoxybutyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 135001484) has the molecular formula C23H35NO8 and a molecular weight of 453.53 g/mol. Its IUPAC name is tert-butyl (4R)-4-[(1S,2R,3R)-4-ethoxy-2,3-dihydroxy-4-oxo-1-phenylmethoxybutyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-4-[(1S,2R,3R)-4-ethoxy-2,3-dihydroxy-4-oxo-1-phenylmethoxybutyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 135001484 |
| Molecular Formula | C23H35NO8 |
| Molecular Weight | 453.53 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | tert-butyl (4R)-4-[(1S,2R,3R)-4-ethoxy-2,3-dihydroxy-4-oxo-1-phenylmethoxybutyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H](O)[C@@H](O)[C@@H](OCc1ccccc1)[C@H]1COC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H35NO8/c1-7-29-20(27)18(26)17(25)19(30-13-15-11-9-8-10-12-15)16-14-31-23(5,6)24(16)21(28)32-22(2,3)4/h8-12,16-19,25-26H,7,13-14H2,1-6H3/t16-,17-,18-,19+/m1/s1 |
| InChIKey | PBSCPYITZLEKQG-MKXGPGLRSA-N |
| XLogP | 2.23 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.53 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |