C25H39NO9S — CID 135001558
tert-butyl (4R)-4-[(S)-[(4S,5S)-2,2-dimethyl-5-(methylsulfonyloxymethyl)-1,3-dioxolan-4-yl]-phenylmethoxymethyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 135001558) has the molecular formula C25H39NO9S and a molecular weight of 529.65 g/mol. Its IUPAC name is tert-butyl (4R)-4-[(S)-[(4S,5S)-2,2-dimethyl-5-(methylsulfonyloxymethyl)-1,3-dioxolan-4-yl]-phenylmethoxymethyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-4-[(S)-[(4S,5S)-2,2-dimethyl-5-(methylsulfonyloxymethyl)-1,3-dioxolan-4-yl]-phenylmethoxymethyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 135001558 |
| Molecular Formula | C25H39NO9S |
| Molecular Weight | 529.65 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | tert-butyl (4R)-4-[(S)-[(4S,5S)-2,2-dimethyl-5-(methylsulfonyloxymethyl)-1,3-dioxolan-4-yl]-phenylmethoxymethyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]([C@H](OCc2ccccc2)[C@@H]2OC(C)(C)O[C@H]2COS(C)(=O)=O)COC1(C)C |
| InChI | InChI=1S/C25H39NO9S/c1-23(2,3)35-22(27)26-18(15-31-24(26,4)5)20(30-14-17-12-10-9-11-13-17)21-19(16-32-36(8,28)29)33-25(6,7)34-21/h9-13,18-21H,14-16H2,1-8H3/t18-,19+,20+,21-/m1/s1 |
| InChIKey | RJWWJSCMAXXGSG-IVAOSVALSA-N |
| XLogP | 3.44 |
| TPSA | 109.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.65 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|