C25H28FNO4 — CID 135002097
3-O'-ethyl 3-O-methyl (2R,3S)-2-(4-fluorophenyl)-1-methyl-4-[(E)-3-phenylprop-2-enyl]pyrrolidine-3,3-dicarboxylate (PubChem CID 135002097) has the molecular formula C25H28FNO4 and a molecular weight of 425.50 g/mol. Its IUPAC name is 3-O'-ethyl 3-O-methyl (2R,3S)-2-(4-fluorophenyl)-1-methyl-4-[(E)-3-phenylprop-2-enyl]pyrrolidine-3,3-dicarboxylate.
| Compound Name | 3-O'-ethyl 3-O-methyl (2R,3S)-2-(4-fluorophenyl)-1-methyl-4-[(E)-3-phenylprop-2-enyl]pyrrolidine-3,3-dicarboxylate |
|---|---|
| PubChem CID | 135002097 |
| Molecular Formula | C25H28FNO4 |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | 3-O'-ethyl 3-O-methyl (2R,3S)-2-(4-fluorophenyl)-1-methyl-4-[(E)-3-phenylprop-2-enyl]pyrrolidine-3,3-dicarboxylate |
| SMILES | CCOC(=O)[C@@]1(C(=O)OC)C(C/C=C/c2ccccc2)CN(C)[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C25H28FNO4/c1-4-31-24(29)25(23(28)30-3)20(12-8-11-18-9-6-5-7-10-18)17-27(2)22(25)19-13-15-21(26)16-14-19/h5-11,13-16,20,22H,4,12,17H2,1-3H3/b11-8+/t20?,22-,25+/m1/s1 |
| InChIKey | BUWNOVMMEQLABC-ALFNNLBISA-N |
| XLogP | 4.25 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|