C21H32O5 — CID 135002101
5-O-tert-butyl 3-O-methyl (2R,5R)-5-butyl-2-hex-1-ynyl-2H-furan-3,5-dicarboxylate (PubChem CID 135002101) has the molecular formula C21H32O5 and a molecular weight of 364.48 g/mol. Its IUPAC name is 5-O-tert-butyl 3-O-methyl (2R,5R)-5-butyl-2-hex-1-ynyl-2H-furan-3,5-dicarboxylate.
| Compound Name | 5-O-tert-butyl 3-O-methyl (2R,5R)-5-butyl-2-hex-1-ynyl-2H-furan-3,5-dicarboxylate |
|---|---|
| PubChem CID | 135002101 |
| Molecular Formula | C21H32O5 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 5-O-tert-butyl 3-O-methyl (2R,5R)-5-butyl-2-hex-1-ynyl-2H-furan-3,5-dicarboxylate |
| SMILES | CCCCC#C[C@H]1O[C@@](CCCC)(C(=O)OC(C)(C)C)C=C1C(=O)OC |
| InChI | InChI=1S/C21H32O5/c1-7-9-11-12-13-17-16(18(22)24-6)15-21(25-17,14-10-8-2)19(23)26-20(3,4)5/h15,17H,7-11,14H2,1-6H3/t17-,21-/m1/s1 |
| InChIKey | UGWOHYFPNUJKOT-DYESRHJHSA-N |
| XLogP | 3.95 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|