C32H27N3O8 — CID 135002105
tetramethyl 1,3,4-triphenyl-1,2,4-triazaspiro[4.4]nona-2,6,8-triene-6,7,8,9-tetracarboxylate (PubChem CID 135002105) has the molecular formula C32H27N3O8 and a molecular weight of 581.58 g/mol. Its IUPAC name is tetramethyl 1,3,4-triphenyl-1,2,4-triazaspiro[4.4]nona-2,6,8-triene-6,7,8,9-tetracarboxylate.
| Compound Name | tetramethyl 1,3,4-triphenyl-1,2,4-triazaspiro[4.4]nona-2,6,8-triene-6,7,8,9-tetracarboxylate |
|---|---|
| PubChem CID | 135002105 |
| Molecular Formula | C32H27N3O8 |
| Molecular Weight | 581.58 g/mol |
| Exact Mass | 581.18 |
| IUPAC Name | tetramethyl 1,3,4-triphenyl-1,2,4-triazaspiro[4.4]nona-2,6,8-triene-6,7,8,9-tetracarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2(C(C(=O)OC)=C1C(=O)OC)N(c1ccccc1)N=C(c1ccccc1)N2c1ccccc1 |
| InChI | InChI=1S/C32H27N3O8/c1-40-28(36)23-24(29(37)41-2)26(31(39)43-4)32(25(23)30(38)42-3)34(21-16-10-6-11-17-21)27(20-14-8-5-9-15-20)33-35(32)22-18-12-7-13-19-22/h5-19H,1-4H3 |
| InChIKey | WGIXDLDTCBJGLL-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 124.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.58 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|