C17H21NO7 — CID 135002106
diethyl (2R,4R,5S)-2-methyl-5-(4-nitrophenyl)oxolane-2,4-dicarboxylate (PubChem CID 135002106) has the molecular formula C17H21NO7 and a molecular weight of 351.36 g/mol. Its IUPAC name is diethyl (2R,4R,5S)-2-methyl-5-(4-nitrophenyl)oxolane-2,4-dicarboxylate.
| Compound Name | diethyl (2R,4R,5S)-2-methyl-5-(4-nitrophenyl)oxolane-2,4-dicarboxylate |
|---|---|
| PubChem CID | 135002106 |
| Molecular Formula | C17H21NO7 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | diethyl (2R,4R,5S)-2-methyl-5-(4-nitrophenyl)oxolane-2,4-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@](C)(C(=O)OCC)O[C@@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H21NO7/c1-4-23-15(19)13-10-17(3,16(20)24-5-2)25-14(13)11-6-8-12(9-7-11)18(21)22/h6-9,13-14H,4-5,10H2,1-3H3/t13-,14-,17-/m1/s1 |
| InChIKey | YDHWXRRKUBFQGE-CKEIUWERSA-N |
| XLogP | 2.56 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|