C18H36OSi — CID 135002116
triethyl-[(1Z,4E)-4-ethyl-3-propylhepta-1,4-dienoxy]silane (PubChem CID 135002116) has the molecular formula C18H36OSi and a molecular weight of 296.57 g/mol. Its IUPAC name is triethyl-[(1Z,4E)-4-ethyl-3-propylhepta-1,4-dienoxy]silane.
| Compound Name | triethyl-[(1Z,4E)-4-ethyl-3-propylhepta-1,4-dienoxy]silane |
|---|---|
| PubChem CID | 135002116 |
| Molecular Formula | C18H36OSi |
| Molecular Weight | 296.57 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | triethyl-[(1Z,4E)-4-ethyl-3-propylhepta-1,4-dienoxy]silane |
| SMILES | CC/C=C(\CC)C(/C=C\O[Si](CC)(CC)CC)CCC |
| InChI | InChI=1S/C18H36OSi/c1-7-13-17(9-3)18(14-8-2)15-16-19-20(10-4,11-5)12-6/h13,15-16,18H,7-12,14H2,1-6H3/b16-15-,17-13+ |
| InChIKey | IUUYSTZDMCZKPY-FGNGAWNESA-N |
| XLogP | 6.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.57 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|