C16H25NSi — CID 135002130
trimethyl-[3-(1-phenylpyrrolidin-2-yl)prop-1-en-2-yl]silane (PubChem CID 135002130) has the molecular formula C16H25NSi and a molecular weight of 259.47 g/mol. Its IUPAC name is trimethyl-[3-(1-phenylpyrrolidin-2-yl)prop-1-en-2-yl]silane.
| Compound Name | trimethyl-[3-(1-phenylpyrrolidin-2-yl)prop-1-en-2-yl]silane |
|---|---|
| PubChem CID | 135002130 |
| Molecular Formula | C16H25NSi |
| Molecular Weight | 259.47 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | trimethyl-[3-(1-phenylpyrrolidin-2-yl)prop-1-en-2-yl]silane |
| SMILES | C=C(CC1CCCN1c1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C16H25NSi/c1-14(18(2,3)4)13-16-11-8-12-17(16)15-9-6-5-7-10-15/h5-7,9-10,16H,1,8,11-13H2,2-4H3 |
| InChIKey | FAVQZAADHFVJNN-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.47 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|