C17H21NO4 — CID 135002277
methyl 1-tert-butylimino-5,6-dimethoxyindene-2-carboxylate (PubChem CID 135002277) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is methyl 1-tert-butylimino-5,6-dimethoxyindene-2-carboxylate.
| Compound Name | methyl 1-tert-butylimino-5,6-dimethoxyindene-2-carboxylate |
|---|---|
| PubChem CID | 135002277 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | methyl 1-tert-butylimino-5,6-dimethoxyindene-2-carboxylate |
| SMILES | COC(=O)C1=Cc2cc(OC)c(OC)cc2/C1=N\C(C)(C)C |
| InChI | InChI=1S/C17H21NO4/c1-17(2,3)18-15-11-9-14(21-5)13(20-4)8-10(11)7-12(15)16(19)22-6/h7-9H,1-6H3/b18-15+ |
| InChIKey | FZFLWFPLPXMHGL-OBGWFSINSA-N |
| XLogP | 2.86 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|