C15H8BrF4N — CID 135002342
3-(4-bromo-2,3,5,6-tetrafluorophenyl)-1-methylindole (PubChem CID 135002342) has the molecular formula C15H8BrF4N and a molecular weight of 358.13 g/mol. Its IUPAC name is 3-(4-bromo-2,3,5,6-tetrafluorophenyl)-1-methylindole.
| Compound Name | 3-(4-bromo-2,3,5,6-tetrafluorophenyl)-1-methylindole |
|---|---|
| PubChem CID | 135002342 |
| Molecular Formula | C15H8BrF4N |
| Molecular Weight | 358.13 g/mol |
| Exact Mass | 356.98 |
| IUPAC Name | 3-(4-bromo-2,3,5,6-tetrafluorophenyl)-1-methylindole |
| SMILES | Cn1cc(-c2c(F)c(F)c(Br)c(F)c2F)c2ccccc21 |
| InChI | InChI=1S/C15H8BrF4N/c1-21-6-8(7-4-2-3-5-9(7)21)10-12(17)14(19)11(16)15(20)13(10)18/h2-6H,1H3 |
| InChIKey | MJHHVNFOZYCRFU-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.13 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|