C26H27NO4 — CID 135002553
(1S,8R)-1-[(E)-2-methoxyhept-2-en-3-yl]-11-phenyl-14-oxa-11-azatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-10,12-dione (PubChem CID 135002553) has the molecular formula C26H27NO4 and a molecular weight of 417.51 g/mol. Its IUPAC name is (1S,8R)-1-[(E)-2-methoxyhept-2-en-3-yl]-11-phenyl-14-oxa-11-azatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-10,12-dione.
| Compound Name | (1S,8R)-1-[(E)-2-methoxyhept-2-en-3-yl]-11-phenyl-14-oxa-11-azatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-10,12-dione |
|---|---|
| PubChem CID | 135002553 |
| Molecular Formula | C26H27NO4 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | (1S,8R)-1-[(E)-2-methoxyhept-2-en-3-yl]-11-phenyl-14-oxa-11-azatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-10,12-dione |
| SMILES | CCCC/C(=C(/C)OC)[C@@]12O[C@@H](c3ccccc31)C1C(=O)N(c3ccccc3)C(=O)C12 |
| InChI | InChI=1S/C26H27NO4/c1-4-5-14-19(16(2)30-3)26-20-15-10-9-13-18(20)23(31-26)21-22(26)25(29)27(24(21)28)17-11-7-6-8-12-17/h6-13,15,21-23H,4-5,14H2,1-3H3/b19-16+/t21?,22?,23-,26+/m0/s1 |
| InChIKey | JBECTBQJYJEZMR-LIVDOPDWSA-N |
| XLogP | 4.88 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|