About ethyl (2S)-2-cyano-2-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]-3-phenylpropanoate
ethyl (2S)-2-cyano-2-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]-3-phenylpropanoate (PubChem CID 135002592) has the molecular formula C22H20N2O4
and a molecular weight of 376.41 g/mol. Its IUPAC name is ethyl (2S)-2-cyano-2-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]-3-phenylpropanoate.
Molecular Properties
| Compound Name | ethyl (2S)-2-cyano-2-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]-3-phenylpropanoate |
| PubChem CID | 135002592 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | ethyl (2S)-2-cyano-2-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]-3-phenylpropanoate |
| SMILES | CCOC(=O)[C@@](C#N)(Cc1ccccc1)[C@@H]1CC(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C22H20N2O4/c1-2-28-21(27)22(15-23,14-16-9-5-3-6-10-16)18-13-19(25)24(20(18)26)17-11-7-4-8-12-17/h3-12,18H,2,13-14H2,1H3/t18-,22-/m1/s1 |
| InChIKey | FXDZFTKMPBBZQH-XMSQKQJNSA-N |
| XLogP | 2.88 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2S)-2-cyano-2-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]-3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2S)-2-cyano-2-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]-3-phenylpropanoate?
The IUPAC name of ethyl (2S)-2-cyano-2-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]-3-phenylpropanoate (CID 135002592) is ethyl (2S)-2-cyano-2-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]-3-phenylpropanoate.
What is the SMILES notation for ethyl (2S)-2-cyano-2-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]-3-phenylpropanoate?
The canonical SMILES for ethyl (2S)-2-cyano-2-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]-3-phenylpropanoate is CCOC(=O)[C@@](C#N)(Cc1ccccc1)[C@@H]1CC(=O)N(c2ccccc2)C1=O.
What is the InChIKey of ethyl (2S)-2-cyano-2-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]-3-phenylpropanoate?
The InChIKey is FXDZFTKMPBBZQH-XMSQKQJNSA-N. The full InChI is InChI=1S/C22H20N2O4/c1-2-28-21(27)22(15-23,14-16-9-5-3-6-10-16)18-13-19(25)24(20(18)26)17-11-7-4-8-12-17/h3-12,18H,2,13-14H2,1H3/t18-,22-/m1/s1.
What are the key properties of ethyl (2S)-2-cyano-2-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]-3-phenylpropanoate?
ethyl (2S)-2-cyano-2-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]-3-phenylpropanoate has a molecular weight of 376.41 g/mol, XLogP of 2.88, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2S)-2-cyano-2-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]-3-phenylpropanoate is sourced from PubChem (CID 135002592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).